C21H32 — CID 145135826
ethane;4-[(3E,5Z)-3-ethenyl-2,5-dimethylhepta-3,5-dienyl]-1,2-dimethylbenzene (PubChem CID 145135826) has the molecular formula C21H32 and a molecular weight of 284.49 g/mol. Its IUPAC name is ethane;4-[(3E,5Z)-3-ethenyl-2,5-dimethylhepta-3,5-dienyl]-1,2-dimethylbenzene.
| Compound Name | ethane;4-[(3E,5Z)-3-ethenyl-2,5-dimethylhepta-3,5-dienyl]-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 145135826 |
| Molecular Formula | C21H32 |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | ethane;4-[(3E,5Z)-3-ethenyl-2,5-dimethylhepta-3,5-dienyl]-1,2-dimethylbenzene |
| SMILES | C=C/C(=C\C(C)=C/C)C(C)Cc1ccc(C)c(C)c1.CC |
| InChI | InChI=1S/C19H26.C2H6/c1-7-14(3)11-19(8-2)17(6)13-18-10-9-15(4)16(5)12-18;1-2/h7-12,17H,2,13H2,1,3-6H3;1-2H3/b14-7-,19-11+; |
| InChIKey | DCUAXOJBTIDZBW-XLCYLVPXSA-N |
| XLogP | 6.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|