C23H42OS — CID 145135868
butan-1-ol;(1E)-2-[1-(3,4-dimethylphenyl)propan-2-yl]buta-1,3-diene-1-thiol;ethane (PubChem CID 145135868) has the molecular formula C23H42OS and a molecular weight of 366.66 g/mol. Its IUPAC name is butan-1-ol;(1E)-2-[1-(3,4-dimethylphenyl)propan-2-yl]buta-1,3-diene-1-thiol;ethane.
| Compound Name | butan-1-ol;(1E)-2-[1-(3,4-dimethylphenyl)propan-2-yl]buta-1,3-diene-1-thiol;ethane |
|---|---|
| PubChem CID | 145135868 |
| Molecular Formula | C23H42OS |
| Molecular Weight | 366.66 g/mol |
| Exact Mass | 366.30 |
| IUPAC Name | butan-1-ol;(1E)-2-[1-(3,4-dimethylphenyl)propan-2-yl]buta-1,3-diene-1-thiol;ethane |
| SMILES | C=C/C(=C\S)C(C)Cc1ccc(C)c(C)c1.CC.CC.CCCCO |
| InChI | InChI=1S/C15H20S.C4H10O.2C2H6/c1-5-15(10-16)13(4)9-14-7-6-11(2)12(3)8-14;1-2-3-4-5;2*1-2/h5-8,10,13,16H,1,9H2,2-4H3;5H,2-4H2,1H3;2*1-2H3/b15-10+;;; |
| InChIKey | PJWUNGQHTAPFQQ-RJQKUYQSSA-N |
| XLogP | 7.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.66 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|