C26H38O2 — CID 125467183
[4-[(4R)-4-[(3,4-dimethylphenyl)methyl]octoxy]-3,5-dimethylphenyl]methanol (PubChem CID 125467183) has the molecular formula C26H38O2 and a molecular weight of 382.59 g/mol. Its IUPAC name is [4-[(4R)-4-[(3,4-dimethylphenyl)methyl]octoxy]-3,5-dimethylphenyl]methanol.
| Compound Name | [4-[(4R)-4-[(3,4-dimethylphenyl)methyl]octoxy]-3,5-dimethylphenyl]methanol |
|---|---|
| PubChem CID | 125467183 |
| Molecular Formula | C26H38O2 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | [4-[(4R)-4-[(3,4-dimethylphenyl)methyl]octoxy]-3,5-dimethylphenyl]methanol |
| SMILES | CCCC[C@H](CCCOc1c(C)cc(CO)cc1C)Cc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C26H38O2/c1-6-7-9-23(17-24-12-11-19(2)20(3)14-24)10-8-13-28-26-21(4)15-25(18-27)16-22(26)5/h11-12,14-16,23,27H,6-10,13,17-18H2,1-5H3/t23-/m1/s1 |
| InChIKey | CPZHKXUIDILWSM-HSZRJFAPSA-N |
| XLogP | 6.62 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|