C24H31BrO2 — CID 125464811
3-bromo-4-[(4R)-4-[(3,4-dimethylphenyl)methyl]octoxy]benzaldehyde (PubChem CID 125464811) has the molecular formula C24H31BrO2 and a molecular weight of 431.41 g/mol. Its IUPAC name is 3-bromo-4-[(4R)-4-[(3,4-dimethylphenyl)methyl]octoxy]benzaldehyde.
| Compound Name | 3-bromo-4-[(4R)-4-[(3,4-dimethylphenyl)methyl]octoxy]benzaldehyde |
|---|---|
| PubChem CID | 125464811 |
| Molecular Formula | C24H31BrO2 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 3-bromo-4-[(4R)-4-[(3,4-dimethylphenyl)methyl]octoxy]benzaldehyde |
| SMILES | CCCC[C@H](CCCOc1ccc(C=O)cc1Br)Cc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C24H31BrO2/c1-4-5-7-20(15-21-10-9-18(2)19(3)14-21)8-6-13-27-24-12-11-22(17-26)16-23(24)25/h9-12,14,16-17,20H,4-8,13,15H2,1-3H3/t20-/m1/s1 |
| InChIKey | MYFALTQVEWXFOZ-HXUWFJFHSA-N |
| XLogP | 7.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|