C26H26F2O2 — CID 125464999
4-[(4S)-4-(2,6-difluorophenyl)-5-(3,4-dimethylphenyl)pentoxy]benzaldehyde (PubChem CID 125464999) has the molecular formula C26H26F2O2 and a molecular weight of 408.49 g/mol. Its IUPAC name is 4-[(4S)-4-(2,6-difluorophenyl)-5-(3,4-dimethylphenyl)pentoxy]benzaldehyde.
| Compound Name | 4-[(4S)-4-(2,6-difluorophenyl)-5-(3,4-dimethylphenyl)pentoxy]benzaldehyde |
|---|---|
| PubChem CID | 125464999 |
| Molecular Formula | C26H26F2O2 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 4-[(4S)-4-(2,6-difluorophenyl)-5-(3,4-dimethylphenyl)pentoxy]benzaldehyde |
| SMILES | Cc1ccc(C[C@H](CCCOc2ccc(C=O)cc2)c2c(F)cccc2F)cc1C |
| InChI | InChI=1S/C26H26F2O2/c1-18-8-9-21(15-19(18)2)16-22(26-24(27)6-3-7-25(26)28)5-4-14-30-23-12-10-20(17-29)11-13-23/h3,6-13,15,17,22H,4-5,14,16H2,1-2H3/t22-/m0/s1 |
| InChIKey | XZTPRNKBWHLOJX-QFIPXVFZSA-N |
| XLogP | 6.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|