C27H28F2O — CID 125464909
4-[(5S)-5-(3,5-difluorophenyl)-6-(3,4-dimethylphenyl)hexyl]benzaldehyde (PubChem CID 125464909) has the molecular formula C27H28F2O and a molecular weight of 406.52 g/mol. Its IUPAC name is 4-[(5S)-5-(3,5-difluorophenyl)-6-(3,4-dimethylphenyl)hexyl]benzaldehyde.
| Compound Name | 4-[(5S)-5-(3,5-difluorophenyl)-6-(3,4-dimethylphenyl)hexyl]benzaldehyde |
|---|---|
| PubChem CID | 125464909 |
| Molecular Formula | C27H28F2O |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 4-[(5S)-5-(3,5-difluorophenyl)-6-(3,4-dimethylphenyl)hexyl]benzaldehyde |
| SMILES | Cc1ccc(C[C@H](CCCCc2ccc(C=O)cc2)c2cc(F)cc(F)c2)cc1C |
| InChI | InChI=1S/C27H28F2O/c1-19-7-8-23(13-20(19)2)14-24(25-15-26(28)17-27(29)16-25)6-4-3-5-21-9-11-22(18-30)12-10-21/h7-13,15-18,24H,3-6,14H2,1-2H3/t24-/m0/s1 |
| InChIKey | RKEUXHXXQNPWIS-DEOSSOPVSA-N |
| XLogP | 7.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|