C31H35F2NO2 — CID 90659696
1-[[4-[5-(3,5-difluorophenyl)-6-(3,4-dimethylphenyl)hexyl]phenyl]methyl]azetidine-3-carboxylic acid (PubChem CID 90659696) has the molecular formula C31H35F2NO2 and a molecular weight of 491.62 g/mol. Its IUPAC name is 1-[[4-[5-(3,5-difluorophenyl)-6-(3,4-dimethylphenyl)hexyl]phenyl]methyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[[4-[5-(3,5-difluorophenyl)-6-(3,4-dimethylphenyl)hexyl]phenyl]methyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 90659696 |
| Molecular Formula | C31H35F2NO2 |
| Molecular Weight | 491.62 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | 1-[[4-[5-(3,5-difluorophenyl)-6-(3,4-dimethylphenyl)hexyl]phenyl]methyl]azetidine-3-carboxylic acid |
| SMILES | Cc1ccc(CC(CCCCc2ccc(CN3CC(C(=O)O)C3)cc2)c2cc(F)cc(F)c2)cc1C |
| InChI | InChI=1S/C31H35F2NO2/c1-21-7-8-25(13-22(21)2)14-26(27-15-29(32)17-30(33)16-27)6-4-3-5-23-9-11-24(12-10-23)18-34-19-28(20-34)31(35)36/h7-13,15-17,26,28H,3-6,14,18-20H2,1-2H3,(H,35,36) |
| InChIKey | AULZFAHSZSHALF-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.62 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|