C30H33F2NO3 — CID 118142620
1-[[4-[4-(2,5-difluorophenyl)-5-(3,4-dimethylphenyl)pentoxy]phenyl]methyl]azetidine-3-carboxylic acid (PubChem CID 118142620) has the molecular formula C30H33F2NO3 and a molecular weight of 493.59 g/mol. Its IUPAC name is 1-[[4-[4-(2,5-difluorophenyl)-5-(3,4-dimethylphenyl)pentoxy]phenyl]methyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[[4-[4-(2,5-difluorophenyl)-5-(3,4-dimethylphenyl)pentoxy]phenyl]methyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 118142620 |
| Molecular Formula | C30H33F2NO3 |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | 1-[[4-[4-(2,5-difluorophenyl)-5-(3,4-dimethylphenyl)pentoxy]phenyl]methyl]azetidine-3-carboxylic acid |
| SMILES | Cc1ccc(CC(CCCOc2ccc(CN3CC(C(=O)O)C3)cc2)c2cc(F)ccc2F)cc1C |
| InChI | InChI=1S/C30H33F2NO3/c1-20-5-6-23(14-21(20)2)15-24(28-16-26(31)9-12-29(28)32)4-3-13-36-27-10-7-22(8-11-27)17-33-18-25(19-33)30(34)35/h5-12,14,16,24-25H,3-4,13,15,17-19H2,1-2H3,(H,34,35) |
| InChIKey | NUVHABNXYIHJGF-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|