C26H28F2O2 — CID 125467229
[4-[(4S)-4-(2,6-difluorophenyl)-5-(3,4-dimethylphenyl)pentoxy]phenyl]methanol (PubChem CID 125467229) has the molecular formula C26H28F2O2 and a molecular weight of 410.50 g/mol. Its IUPAC name is [4-[(4S)-4-(2,6-difluorophenyl)-5-(3,4-dimethylphenyl)pentoxy]phenyl]methanol.
| Compound Name | [4-[(4S)-4-(2,6-difluorophenyl)-5-(3,4-dimethylphenyl)pentoxy]phenyl]methanol |
|---|---|
| PubChem CID | 125467229 |
| Molecular Formula | C26H28F2O2 |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | [4-[(4S)-4-(2,6-difluorophenyl)-5-(3,4-dimethylphenyl)pentoxy]phenyl]methanol |
| SMILES | Cc1ccc(C[C@H](CCCOc2ccc(CO)cc2)c2c(F)cccc2F)cc1C |
| InChI | InChI=1S/C26H28F2O2/c1-18-8-9-21(15-19(18)2)16-22(26-24(27)6-3-7-25(26)28)5-4-14-30-23-12-10-20(17-29)11-13-23/h3,6-13,15,22,29H,4-5,14,16-17H2,1-2H3/t22-/m0/s1 |
| InChIKey | HHNGVRGWARMMCN-QFIPXVFZSA-N |
| XLogP | 6.26 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|