C29H35ClO — CID 123635712
4-[5-(4-butylphenoxy)-2-(3-chlorophenyl)pentyl]-1,2-dimethylbenzene (PubChem CID 123635712) has the molecular formula C29H35ClO and a molecular weight of 435.05 g/mol. Its IUPAC name is 4-[5-(4-butylphenoxy)-2-(3-chlorophenyl)pentyl]-1,2-dimethylbenzene.
| Compound Name | 4-[5-(4-butylphenoxy)-2-(3-chlorophenyl)pentyl]-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 123635712 |
| Molecular Formula | C29H35ClO |
| Molecular Weight | 435.05 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 4-[5-(4-butylphenoxy)-2-(3-chlorophenyl)pentyl]-1,2-dimethylbenzene |
| SMILES | CCCCc1ccc(OCCCC(Cc2ccc(C)c(C)c2)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C29H35ClO/c1-4-5-8-24-14-16-29(17-15-24)31-18-7-10-26(27-9-6-11-28(30)21-27)20-25-13-12-22(2)23(3)19-25/h6,9,11-17,19,21,26H,4-5,7-8,10,18,20H2,1-3H3 |
| InChIKey | BFXQUHYSRFPVBV-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.05 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|