C27H31ClS — CID 144683400
4-[2-(3-chlorophenyl)-5-(4-ethylphenyl)sulfanylpentyl]-1,2-dimethylbenzene (PubChem CID 144683400) has the molecular formula C27H31ClS and a molecular weight of 423.07 g/mol. Its IUPAC name is 4-[2-(3-chlorophenyl)-5-(4-ethylphenyl)sulfanylpentyl]-1,2-dimethylbenzene.
| Compound Name | 4-[2-(3-chlorophenyl)-5-(4-ethylphenyl)sulfanylpentyl]-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 144683400 |
| Molecular Formula | C27H31ClS |
| Molecular Weight | 423.07 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 4-[2-(3-chlorophenyl)-5-(4-ethylphenyl)sulfanylpentyl]-1,2-dimethylbenzene |
| SMILES | CCc1ccc(SCCCC(Cc2ccc(C)c(C)c2)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C27H31ClS/c1-4-22-12-14-27(15-13-22)29-16-6-8-24(25-7-5-9-26(28)19-25)18-23-11-10-20(2)21(3)17-23/h5,7,9-15,17,19,24H,4,6,8,16,18H2,1-3H3 |
| InChIKey | WWRRPKZLMNJCBI-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.07 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|