C19H25N — CID 116544264
2-(3,4-dimethylphenyl)-1-(3-propylphenyl)ethanamine (PubChem CID 116544264) has the molecular formula C19H25N and a molecular weight of 267.42 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-1-(3-propylphenyl)ethanamine.
| Compound Name | 2-(3,4-dimethylphenyl)-1-(3-propylphenyl)ethanamine |
|---|---|
| PubChem CID | 116544264 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-1-(3-propylphenyl)ethanamine |
| SMILES | CCCc1cccc(C(N)Cc2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C19H25N/c1-4-6-16-7-5-8-18(12-16)19(20)13-17-10-9-14(2)15(3)11-17/h5,7-12,19H,4,6,13,20H2,1-3H3 |
| InChIKey | OCOATKJIRIWZAU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |