C17H19ClFN — CID 116545044
2-(3-chloro-2-fluorophenyl)-1-(3-propylphenyl)ethanamine (PubChem CID 116545044) has the molecular formula C17H19ClFN and a molecular weight of 291.80 g/mol. Its IUPAC name is 2-(3-chloro-2-fluorophenyl)-1-(3-propylphenyl)ethanamine.
| Compound Name | 2-(3-chloro-2-fluorophenyl)-1-(3-propylphenyl)ethanamine |
|---|---|
| PubChem CID | 116545044 |
| Molecular Formula | C17H19ClFN |
| Molecular Weight | 291.80 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 2-(3-chloro-2-fluorophenyl)-1-(3-propylphenyl)ethanamine |
| SMILES | CCCc1cccc(C(N)Cc2cccc(Cl)c2F)c1 |
| InChI | InChI=1S/C17H19ClFN/c1-2-5-12-6-3-7-13(10-12)16(20)11-14-8-4-9-15(18)17(14)19/h3-4,6-10,16H,2,5,11,20H2,1H3 |
| InChIKey | OCJIMXJVRZYMJH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.80 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |