C27H36ClNO2 — CID 125489500
1-[(8S)-8-(3-chlorophenyl)-9-(3,4-dimethylphenyl)nonyl]azetidine-3-carboxylic acid (PubChem CID 125489500) has the molecular formula C27H36ClNO2 and a molecular weight of 442.04 g/mol. Its IUPAC name is 1-[(8S)-8-(3-chlorophenyl)-9-(3,4-dimethylphenyl)nonyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[(8S)-8-(3-chlorophenyl)-9-(3,4-dimethylphenyl)nonyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 125489500 |
| Molecular Formula | C27H36ClNO2 |
| Molecular Weight | 442.04 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 1-[(8S)-8-(3-chlorophenyl)-9-(3,4-dimethylphenyl)nonyl]azetidine-3-carboxylic acid |
| SMILES | Cc1ccc(C[C@H](CCCCCCCN2CC(C(=O)O)C2)c2cccc(Cl)c2)cc1C |
| InChI | InChI=1S/C27H36ClNO2/c1-20-12-13-22(15-21(20)2)16-23(24-10-8-11-26(28)17-24)9-6-4-3-5-7-14-29-18-25(19-29)27(30)31/h8,10-13,15,17,23,25H,3-7,9,14,16,18-19H2,1-2H3,(H,30,31)/t23-/m0/s1 |
| InChIKey | HXJXUUQICRCHTM-QHCPKHFHSA-N |
| XLogP | 6.64 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.04 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|