C31H36F2O2 — CID 157410806
5-[4-[5-(3,5-difluorophenyl)-6-(3,4-dimethylphenyl)hexyl]phenyl]pentanoic acid (PubChem CID 157410806) has the molecular formula C31H36F2O2 and a molecular weight of 478.62 g/mol. Its IUPAC name is 5-[4-[5-(3,5-difluorophenyl)-6-(3,4-dimethylphenyl)hexyl]phenyl]pentanoic acid.
| Compound Name | 5-[4-[5-(3,5-difluorophenyl)-6-(3,4-dimethylphenyl)hexyl]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 157410806 |
| Molecular Formula | C31H36F2O2 |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | 5-[4-[5-(3,5-difluorophenyl)-6-(3,4-dimethylphenyl)hexyl]phenyl]pentanoic acid |
| SMILES | Cc1ccc(CC(CCCCc2ccc(CCCCC(=O)O)cc2)c2cc(F)cc(F)c2)cc1C |
| InChI | InChI=1S/C31H36F2O2/c1-22-11-12-26(17-23(22)2)18-27(28-19-29(32)21-30(33)20-28)9-5-3-7-24-13-15-25(16-14-24)8-4-6-10-31(34)35/h11-17,19-21,27H,3-10,18H2,1-2H3,(H,34,35) |
| InChIKey | BOGOKJCYIDRXTI-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|