C26H35F2NO2 — CID 125469233
3-[[(8S)-8-(3,5-difluorophenyl)-9-(3,4-dimethylphenyl)nonyl]amino]propanoic acid (PubChem CID 125469233) has the molecular formula C26H35F2NO2 and a molecular weight of 431.57 g/mol. Its IUPAC name is 3-[[(8S)-8-(3,5-difluorophenyl)-9-(3,4-dimethylphenyl)nonyl]amino]propanoic acid.
| Compound Name | 3-[[(8S)-8-(3,5-difluorophenyl)-9-(3,4-dimethylphenyl)nonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 125469233 |
| Molecular Formula | C26H35F2NO2 |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | 3-[[(8S)-8-(3,5-difluorophenyl)-9-(3,4-dimethylphenyl)nonyl]amino]propanoic acid |
| SMILES | Cc1ccc(C[C@H](CCCCCCCNCCC(=O)O)c2cc(F)cc(F)c2)cc1C |
| InChI | InChI=1S/C26H35F2NO2/c1-19-9-10-21(14-20(19)2)15-22(23-16-24(27)18-25(28)17-23)8-6-4-3-5-7-12-29-13-11-26(30)31/h9-10,14,16-18,22,29H,3-8,11-13,15H2,1-2H3,(H,30,31)/t22-/m0/s1 |
| InChIKey | FACLNSVDXZWJOI-QFIPXVFZSA-N |
| XLogP | 6.31 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|