C29H29ClO2 — CID 147652068
5-[4-[3-(4-chlorophenyl)-4-(3,4-dimethylphenyl)but-1-ynyl]phenyl]pentanoic acid (PubChem CID 147652068) has the molecular formula C29H29ClO2 and a molecular weight of 445.00 g/mol. Its IUPAC name is 5-[4-[3-(4-chlorophenyl)-4-(3,4-dimethylphenyl)but-1-ynyl]phenyl]pentanoic acid.
| Compound Name | 5-[4-[3-(4-chlorophenyl)-4-(3,4-dimethylphenyl)but-1-ynyl]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 147652068 |
| Molecular Formula | C29H29ClO2 |
| Molecular Weight | 445.00 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 5-[4-[3-(4-chlorophenyl)-4-(3,4-dimethylphenyl)but-1-ynyl]phenyl]pentanoic acid |
| SMILES | Cc1ccc(CC(C#Cc2ccc(CCCCC(=O)O)cc2)c2ccc(Cl)cc2)cc1C |
| InChI | InChI=1S/C29H29ClO2/c1-21-7-8-25(19-22(21)2)20-27(26-15-17-28(30)18-16-26)14-13-24-11-9-23(10-12-24)5-3-4-6-29(31)32/h7-12,15-19,27H,3-6,20H2,1-2H3,(H,31,32) |
| InChIKey | GJRSVINEPKUCOZ-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.00 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|