C23H32O4S2 — CID 18954428
4-[1-(3-carboxypropylsulfanyl)-3-(4-hexylphenyl)prop-2-ynyl]sulfanylbutanoic acid (PubChem CID 18954428) has the molecular formula C23H32O4S2 and a molecular weight of 436.64 g/mol. Its IUPAC name is 4-[1-(3-carboxypropylsulfanyl)-3-(4-hexylphenyl)prop-2-ynyl]sulfanylbutanoic acid.
| Compound Name | 4-[1-(3-carboxypropylsulfanyl)-3-(4-hexylphenyl)prop-2-ynyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 18954428 |
| Molecular Formula | C23H32O4S2 |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 4-[1-(3-carboxypropylsulfanyl)-3-(4-hexylphenyl)prop-2-ynyl]sulfanylbutanoic acid |
| SMILES | CCCCCCc1ccc(C#CC(SCCCC(=O)O)SCCCC(=O)O)cc1 |
| InChI | InChI=1S/C23H32O4S2/c1-2-3-4-5-8-19-11-13-20(14-12-19)15-16-23(28-17-6-9-21(24)25)29-18-7-10-22(26)27/h11-14,23H,2-10,17-18H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | ZNFQUWGATNEBAI-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|