C21H28O — CID 167507380
1-(4-decylphenyl)penta-1,4-diyn-3-ol (PubChem CID 167507380) has the molecular formula C21H28O and a molecular weight of 296.45 g/mol. Its IUPAC name is 1-(4-decylphenyl)penta-1,4-diyn-3-ol.
| Compound Name | 1-(4-decylphenyl)penta-1,4-diyn-3-ol |
|---|---|
| PubChem CID | 167507380 |
| Molecular Formula | C21H28O |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 1-(4-decylphenyl)penta-1,4-diyn-3-ol |
| SMILES | C#CC(O)C#Cc1ccc(CCCCCCCCCC)cc1 |
| InChI | InChI=1S/C21H28O/c1-3-5-6-7-8-9-10-11-12-19-13-15-20(16-14-19)17-18-21(22)4-2/h2,13-16,21-22H,3,5-12H2,1H3 |
| InChIKey | WQUUZFRFPZCKKK-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|