C19H26OS — CID 167507425
1-(5-decylthiophen-2-yl)penta-1,4-diyn-3-ol (PubChem CID 167507425) has the molecular formula C19H26OS and a molecular weight of 302.48 g/mol. Its IUPAC name is 1-(5-decylthiophen-2-yl)penta-1,4-diyn-3-ol.
| Compound Name | 1-(5-decylthiophen-2-yl)penta-1,4-diyn-3-ol |
|---|---|
| PubChem CID | 167507425 |
| Molecular Formula | C19H26OS |
| Molecular Weight | 302.48 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 1-(5-decylthiophen-2-yl)penta-1,4-diyn-3-ol |
| SMILES | C#CC(O)C#Cc1ccc(CCCCCCCCCC)s1 |
| InChI | InChI=1S/C19H26OS/c1-3-5-6-7-8-9-10-11-12-18-15-16-19(21-18)14-13-17(20)4-2/h2,15-17,20H,3,5-12H2,1H3 |
| InChIKey | KSITTWAQAXXXLB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.48 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|