sodium (5-hexylthiophen-2-yl)-trihydroxyboranuide

C10H18BNaO3S — CID 23684329

IUPACsodium (5-hexylthiophen-2-yl)-trihydroxyboranuide
SMILESCCCCCCc1ccc([B-](O)(O)O)s1.[Na+]
InChIInChI=1S/C10H18BO3S.Na/c1-2-3-4-5-6-9-7-8-10(15-9)11(12,13)14;/h7-8,12-14H,2-6H2,1H3;/q-1;+1
InChIKeyWTKDJZXTZSDMSZ-UHFFFAOYSA-N
MW252.12 g/mol
LogP-2.00
Rot. Bonds6

About sodium (5-hexylthiophen-2-yl)-trihydroxyboranuide

sodium (5-hexylthiophen-2-yl)-trihydroxyboranuide (PubChem CID 23684329) has the molecular formula C10H18BNaO3S and a molecular weight of 252.12 g/mol. Its IUPAC name is sodium (5-hexylthiophen-2-yl)-trihydroxyboranuide.

Molecular Properties

Compound Namesodium (5-hexylthiophen-2-yl)-trihydroxyboranuide
PubChem CID23684329
Molecular FormulaC10H18BNaO3S
Molecular Weight252.12 g/mol
Exact Mass252.10
IUPAC Namesodium (5-hexylthiophen-2-yl)-trihydroxyboranuide
SMILESCCCCCCc1ccc([B-](O)(O)O)s1.[Na+]
InChIInChI=1S/C10H18BO3S.Na/c1-2-3-4-5-6-9-7-8-10(15-9)11(12,13)14;/h7-8,12-14H,2-6H2,1H3;/q-1;+1
InChIKeyWTKDJZXTZSDMSZ-UHFFFAOYSA-N
XLogP-2.00
TPSA60.69 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.12
LogP ≤ 5-2.00
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze sodium (5-hexylthiophen-2-yl)-trihydroxyboranuide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium (5-hexylthiophen-2-yl)-trihydroxyboranuide?
The IUPAC name of sodium (5-hexylthiophen-2-yl)-trihydroxyboranuide (CID 23684329) is sodium (5-hexylthiophen-2-yl)-trihydroxyboranuide.
What is the SMILES notation for sodium (5-hexylthiophen-2-yl)-trihydroxyboranuide?
The canonical SMILES for sodium (5-hexylthiophen-2-yl)-trihydroxyboranuide is CCCCCCc1ccc([B-](O)(O)O)s1.[Na+].
What is the InChIKey of sodium (5-hexylthiophen-2-yl)-trihydroxyboranuide?
The InChIKey is WTKDJZXTZSDMSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18BO3S.Na/c1-2-3-4-5-6-9-7-8-10(15-9)11(12,13)14;/h7-8,12-14H,2-6H2,1H3;/q-1;+1.
What are the key properties of sodium (5-hexylthiophen-2-yl)-trihydroxyboranuide?
sodium (5-hexylthiophen-2-yl)-trihydroxyboranuide has a molecular weight of 252.12 g/mol, XLogP of -2.00, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium (5-hexylthiophen-2-yl)-trihydroxyboranuide is sourced from PubChem (CID 23684329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).