C27H25ClO — CID 90139517
4-[3-(3-chlorophenyl)-4-(3,4-dimethylphenyl)but-1-ynyl]-2-ethylbenzaldehyde (PubChem CID 90139517) has the molecular formula C27H25ClO and a molecular weight of 400.95 g/mol. Its IUPAC name is 4-[3-(3-chlorophenyl)-4-(3,4-dimethylphenyl)but-1-ynyl]-2-ethylbenzaldehyde.
| Compound Name | 4-[3-(3-chlorophenyl)-4-(3,4-dimethylphenyl)but-1-ynyl]-2-ethylbenzaldehyde |
|---|---|
| PubChem CID | 90139517 |
| Molecular Formula | C27H25ClO |
| Molecular Weight | 400.95 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 4-[3-(3-chlorophenyl)-4-(3,4-dimethylphenyl)but-1-ynyl]-2-ethylbenzaldehyde |
| SMILES | CCc1cc(C#CC(Cc2ccc(C)c(C)c2)c2cccc(Cl)c2)ccc1C=O |
| InChI | InChI=1S/C27H25ClO/c1-4-23-15-21(11-13-26(23)18-29)10-12-25(24-6-5-7-27(28)17-24)16-22-9-8-19(2)20(3)14-22/h5-9,11,13-15,17-18,25H,4,16H2,1-3H3 |
| InChIKey | KOEXOPJQDLXEPN-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.95 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|