C18H22ClN — CID 63412120
2-(3-chlorophenyl)-1-(3,4-dimethylphenyl)-N-ethylethanamine (PubChem CID 63412120) has the molecular formula C18H22ClN and a molecular weight of 287.83 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-(3,4-dimethylphenyl)-N-ethylethanamine.
| Compound Name | 2-(3-chlorophenyl)-1-(3,4-dimethylphenyl)-N-ethylethanamine |
|---|---|
| PubChem CID | 63412120 |
| Molecular Formula | C18H22ClN |
| Molecular Weight | 287.83 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 2-(3-chlorophenyl)-1-(3,4-dimethylphenyl)-N-ethylethanamine |
| SMILES | CCNC(Cc1cccc(Cl)c1)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C18H22ClN/c1-4-20-18(12-15-6-5-7-17(19)11-15)16-9-8-13(2)14(3)10-16/h5-11,18,20H,4,12H2,1-3H3 |
| InChIKey | OOHCNDGUDSIZCF-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.83 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |