C14H15ClINS — CID 79693343
2-(3-chlorophenyl)-N-ethyl-1-(5-iodothiophen-3-yl)ethanamine (PubChem CID 79693343) has the molecular formula C14H15ClINS and a molecular weight of 391.71 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-ethyl-1-(5-iodothiophen-3-yl)ethanamine.
| Compound Name | 2-(3-chlorophenyl)-N-ethyl-1-(5-iodothiophen-3-yl)ethanamine |
|---|---|
| PubChem CID | 79693343 |
| Molecular Formula | C14H15ClINS |
| Molecular Weight | 391.71 g/mol |
| Exact Mass | 390.97 |
| IUPAC Name | 2-(3-chlorophenyl)-N-ethyl-1-(5-iodothiophen-3-yl)ethanamine |
| SMILES | CCNC(Cc1cccc(Cl)c1)c1csc(I)c1 |
| InChI | InChI=1S/C14H15ClINS/c1-2-17-13(11-8-14(16)18-9-11)7-10-4-3-5-12(15)6-10/h3-6,8-9,13,17H,2,7H2,1H3 |
| InChIKey | URBVMHQHTSUVDZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.71 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|