C14H14Cl2INS — CID 115863174
2-(2,5-dichlorophenyl)-N-ethyl-1-(5-iodothiophen-3-yl)ethanamine (PubChem CID 115863174) has the molecular formula C14H14Cl2INS and a molecular weight of 426.15 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-N-ethyl-1-(5-iodothiophen-3-yl)ethanamine.
| Compound Name | 2-(2,5-dichlorophenyl)-N-ethyl-1-(5-iodothiophen-3-yl)ethanamine |
|---|---|
| PubChem CID | 115863174 |
| Molecular Formula | C14H14Cl2INS |
| Molecular Weight | 426.15 g/mol |
| Exact Mass | 424.93 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-N-ethyl-1-(5-iodothiophen-3-yl)ethanamine |
| SMILES | CCNC(Cc1cc(Cl)ccc1Cl)c1csc(I)c1 |
| InChI | InChI=1S/C14H14Cl2INS/c1-2-18-13(10-7-14(17)19-8-10)6-9-5-11(15)3-4-12(9)16/h3-5,7-8,13,18H,2,6H2,1H3 |
| InChIKey | ZIRBYDQMSIWYBP-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.15 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|