C13H12Cl2INS — CID 115863017
2-(2,5-dichlorophenyl)-1-(5-iodothiophen-3-yl)-N-methylethanamine (PubChem CID 115863017) has the molecular formula C13H12Cl2INS and a molecular weight of 412.12 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-1-(5-iodothiophen-3-yl)-N-methylethanamine.
| Compound Name | 2-(2,5-dichlorophenyl)-1-(5-iodothiophen-3-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 115863017 |
| Molecular Formula | C13H12Cl2INS |
| Molecular Weight | 412.12 g/mol |
| Exact Mass | 410.91 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-1-(5-iodothiophen-3-yl)-N-methylethanamine |
| SMILES | CNC(Cc1cc(Cl)ccc1Cl)c1csc(I)c1 |
| InChI | InChI=1S/C13H12Cl2INS/c1-17-12(9-6-13(16)18-7-9)5-8-4-10(14)2-3-11(8)15/h2-4,6-7,12,17H,5H2,1H3 |
| InChIKey | NQZQXISVCVWHRP-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.12 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|