C15H15ClINOS — CID 105031429
2-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)-1-(5-iodothiophen-3-yl)-N-methylethanamine (PubChem CID 105031429) has the molecular formula C15H15ClINOS and a molecular weight of 419.72 g/mol. Its IUPAC name is 2-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)-1-(5-iodothiophen-3-yl)-N-methylethanamine.
| Compound Name | 2-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)-1-(5-iodothiophen-3-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 105031429 |
| Molecular Formula | C15H15ClINOS |
| Molecular Weight | 419.72 g/mol |
| Exact Mass | 418.96 |
| IUPAC Name | 2-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)-1-(5-iodothiophen-3-yl)-N-methylethanamine |
| SMILES | CNC(Cc1cc(Cl)cc2c1OCC2)c1csc(I)c1 |
| InChI | InChI=1S/C15H15ClINOS/c1-18-13(11-7-14(17)20-8-11)6-10-5-12(16)4-9-2-3-19-15(9)10/h4-5,7-8,13,18H,2-3,6H2,1H3 |
| InChIKey | MZAYPDNNQPSYAR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.72 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|