C15H16ClFINS — CID 102622498
N-[2-(2-chloro-5-fluorophenyl)-1-(5-iodothiophen-3-yl)ethyl]propan-1-amine (PubChem CID 102622498) has the molecular formula C15H16ClFINS and a molecular weight of 423.72 g/mol. Its IUPAC name is N-[2-(2-chloro-5-fluorophenyl)-1-(5-iodothiophen-3-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-(2-chloro-5-fluorophenyl)-1-(5-iodothiophen-3-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 102622498 |
| Molecular Formula | C15H16ClFINS |
| Molecular Weight | 423.72 g/mol |
| Exact Mass | 422.97 |
| IUPAC Name | N-[2-(2-chloro-5-fluorophenyl)-1-(5-iodothiophen-3-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1cc(F)ccc1Cl)c1csc(I)c1 |
| InChI | InChI=1S/C15H16ClFINS/c1-2-5-19-14(11-8-15(18)20-9-11)7-10-6-12(17)3-4-13(10)16/h3-4,6,8-9,14,19H,2,5,7H2,1H3 |
| InChIKey | QUXQMBZJEOTIEX-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.72 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|