C18H24INS — CID 115828885
N-[1-(5-iodothiophen-3-yl)-2-(2,4,6-trimethylphenyl)ethyl]propan-1-amine (PubChem CID 115828885) has the molecular formula C18H24INS and a molecular weight of 413.37 g/mol. Its IUPAC name is N-[1-(5-iodothiophen-3-yl)-2-(2,4,6-trimethylphenyl)ethyl]propan-1-amine.
| Compound Name | N-[1-(5-iodothiophen-3-yl)-2-(2,4,6-trimethylphenyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 115828885 |
| Molecular Formula | C18H24INS |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | N-[1-(5-iodothiophen-3-yl)-2-(2,4,6-trimethylphenyl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1c(C)cc(C)cc1C)c1csc(I)c1 |
| InChI | InChI=1S/C18H24INS/c1-5-6-20-17(15-9-18(19)21-11-15)10-16-13(3)7-12(2)8-14(16)4/h7-9,11,17,20H,5-6,10H2,1-4H3 |
| InChIKey | GVRNUXWHJXTJJJ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|