C15H22IN3S — CID 105002687
N-[2-(2-ethyl-5-methylpyrazol-3-yl)-1-(5-iodothiophen-3-yl)ethyl]propan-1-amine (PubChem CID 105002687) has the molecular formula C15H22IN3S and a molecular weight of 403.33 g/mol. Its IUPAC name is N-[2-(2-ethyl-5-methylpyrazol-3-yl)-1-(5-iodothiophen-3-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-(2-ethyl-5-methylpyrazol-3-yl)-1-(5-iodothiophen-3-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 105002687 |
| Molecular Formula | C15H22IN3S |
| Molecular Weight | 403.33 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | N-[2-(2-ethyl-5-methylpyrazol-3-yl)-1-(5-iodothiophen-3-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1cc(C)nn1CC)c1csc(I)c1 |
| InChI | InChI=1S/C15H22IN3S/c1-4-6-17-14(12-8-15(16)20-10-12)9-13-7-11(3)18-19(13)5-2/h7-8,10,14,17H,4-6,9H2,1-3H3 |
| InChIKey | VCJTYSMIUWLYMU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.33 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|