C11H17N5S — CID 105253636
[2-(2-ethyl-5-methylpyrazol-3-yl)-1-(1,3-thiazol-5-yl)ethyl]hydrazine (PubChem CID 105253636) has the molecular formula C11H17N5S and a molecular weight of 251.36 g/mol. Its IUPAC name is [2-(2-ethyl-5-methylpyrazol-3-yl)-1-(1,3-thiazol-5-yl)ethyl]hydrazine.
| Compound Name | [2-(2-ethyl-5-methylpyrazol-3-yl)-1-(1,3-thiazol-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105253636 |
| Molecular Formula | C11H17N5S |
| Molecular Weight | 251.36 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | [2-(2-ethyl-5-methylpyrazol-3-yl)-1-(1,3-thiazol-5-yl)ethyl]hydrazine |
| SMILES | CCn1nc(C)cc1CC(NN)c1cncs1 |
| InChI | InChI=1S/C11H17N5S/c1-3-16-9(4-8(2)15-16)5-10(14-12)11-6-13-7-17-11/h4,6-7,10,14H,3,5,12H2,1-2H3 |
| InChIKey | ARKGHTWFYHVXEH-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.36 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|