C14H21N5 — CID 105219848
[2-(2-ethyl-5-methylpyrazol-3-yl)-1-(4-methyl-2-pyridinyl)ethyl]hydrazine (PubChem CID 105219848) has the molecular formula C14H21N5 and a molecular weight of 259.36 g/mol. Its IUPAC name is [2-(2-ethyl-5-methylpyrazol-3-yl)-1-(4-methyl-2-pyridinyl)ethyl]hydrazine.
| Compound Name | [2-(2-ethyl-5-methylpyrazol-3-yl)-1-(4-methyl-2-pyridinyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105219848 |
| Molecular Formula | C14H21N5 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | [2-(2-ethyl-5-methylpyrazol-3-yl)-1-(4-methyl-2-pyridinyl)ethyl]hydrazine |
| SMILES | CCn1nc(C)cc1CC(NN)c1cc(C)ccn1 |
| InChI | InChI=1S/C14H21N5/c1-4-19-12(8-11(3)18-19)9-14(17-15)13-7-10(2)5-6-16-13/h5-8,14,17H,4,9,15H2,1-3H3 |
| InChIKey | WVHRHJYDWLVENK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|