C11H16INS — CID 105005326
1-(5-iodothiophen-3-yl)-2-methyl-N-propylprop-2-en-1-amine (PubChem CID 105005326) has the molecular formula C11H16INS and a molecular weight of 321.23 g/mol. Its IUPAC name is 1-(5-iodothiophen-3-yl)-2-methyl-N-propylprop-2-en-1-amine.
| Compound Name | 1-(5-iodothiophen-3-yl)-2-methyl-N-propylprop-2-en-1-amine |
|---|---|
| PubChem CID | 105005326 |
| Molecular Formula | C11H16INS |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | 1-(5-iodothiophen-3-yl)-2-methyl-N-propylprop-2-en-1-amine |
| SMILES | C=C(C)C(NCCC)c1csc(I)c1 |
| InChI | InChI=1S/C11H16INS/c1-4-5-13-11(8(2)3)9-6-10(12)14-7-9/h6-7,11,13H,2,4-5H2,1,3H3 |
| InChIKey | AZODYMDWZNEJGD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|