C14H22N2 — CID 107504040
1-(2,6-dimethyl-4-pyridinyl)-2-methyl-N-propylprop-2-en-1-amine (PubChem CID 107504040) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 1-(2,6-dimethyl-4-pyridinyl)-2-methyl-N-propylprop-2-en-1-amine.
| Compound Name | 1-(2,6-dimethyl-4-pyridinyl)-2-methyl-N-propylprop-2-en-1-amine |
|---|---|
| PubChem CID | 107504040 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 1-(2,6-dimethyl-4-pyridinyl)-2-methyl-N-propylprop-2-en-1-amine |
| SMILES | C=C(C)C(NCCC)c1cc(C)nc(C)c1 |
| InChI | InChI=1S/C14H22N2/c1-6-7-15-14(10(2)3)13-8-11(4)16-12(5)9-13/h8-9,14-15H,2,6-7H2,1,3-5H3 |
| InChIKey | DEFRZLSDPMMOHR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|