C14H19F2NO — CID 105005241
1-[4-(difluoromethoxy)phenyl]-2-methyl-N-propylprop-2-en-1-amine (PubChem CID 105005241) has the molecular formula C14H19F2NO and a molecular weight of 255.31 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-2-methyl-N-propylprop-2-en-1-amine.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-2-methyl-N-propylprop-2-en-1-amine |
|---|---|
| PubChem CID | 105005241 |
| Molecular Formula | C14H19F2NO |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-2-methyl-N-propylprop-2-en-1-amine |
| SMILES | C=C(C)C(NCCC)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C14H19F2NO/c1-4-9-17-13(10(2)3)11-5-7-12(8-6-11)18-14(15)16/h5-8,13-14,17H,2,4,9H2,1,3H3 |
| InChIKey | TWJMCAXWZXFCLF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|