C16H23F2NO — CID 105005864
1-[4-(difluoromethoxy)phenyl]-3-methylidene-N-propylpentan-1-amine (PubChem CID 105005864) has the molecular formula C16H23F2NO and a molecular weight of 283.36 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-3-methylidene-N-propylpentan-1-amine.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-3-methylidene-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 105005864 |
| Molecular Formula | C16H23F2NO |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-3-methylidene-N-propylpentan-1-amine |
| SMILES | C=C(CC)CC(NCCC)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C16H23F2NO/c1-4-10-19-15(11-12(3)5-2)13-6-8-14(9-7-13)20-16(17)18/h6-9,15-16,19H,3-5,10-11H2,1-2H3 |
| InChIKey | BNZIGRNPGRKTFF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|