C9H16N4 — CID 79177962
2-methyl-N-propyl-1-(1H-1,2,4-triazol-5-yl)prop-2-en-1-amine (PubChem CID 79177962) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-methyl-N-propyl-1-(1H-1,2,4-triazol-5-yl)prop-2-en-1-amine.
| Compound Name | 2-methyl-N-propyl-1-(1H-1,2,4-triazol-5-yl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 79177962 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 2-methyl-N-propyl-1-(1H-1,2,4-triazol-5-yl)prop-2-en-1-amine |
| SMILES | C=C(C)C(NCCC)c1ncn[nH]1 |
| InChI | InChI=1S/C9H16N4/c1-4-5-10-8(7(2)3)9-11-6-12-13-9/h6,8,10H,2,4-5H2,1,3H3,(H,11,12,13) |
| InChIKey | QWFXPBWWUAJGBE-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|