C15H12BrCl2F2N — CID 107539162
1-(2-bromo-3,4-difluorophenyl)-2-(2,5-dichlorophenyl)-N-methylethanamine (PubChem CID 107539162) has the molecular formula C15H12BrCl2F2N and a molecular weight of 395.07 g/mol. Its IUPAC name is 1-(2-bromo-3,4-difluorophenyl)-2-(2,5-dichlorophenyl)-N-methylethanamine.
| Compound Name | 1-(2-bromo-3,4-difluorophenyl)-2-(2,5-dichlorophenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 107539162 |
| Molecular Formula | C15H12BrCl2F2N |
| Molecular Weight | 395.07 g/mol |
| Exact Mass | 392.95 |
| IUPAC Name | 1-(2-bromo-3,4-difluorophenyl)-2-(2,5-dichlorophenyl)-N-methylethanamine |
| SMILES | CNC(Cc1cc(Cl)ccc1Cl)c1ccc(F)c(F)c1Br |
| InChI | InChI=1S/C15H12BrCl2F2N/c1-21-13(7-8-6-9(17)2-4-11(8)18)10-3-5-12(19)15(20)14(10)16/h2-6,13,21H,7H2,1H3 |
| InChIKey | HATWPJWIYKQPSY-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.07 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|