C15H16BrF2NS — CID 107539084
1-(2-bromo-3,4-difluorophenyl)-2-(5-ethylthiophen-2-yl)-N-methylethanamine (PubChem CID 107539084) has the molecular formula C15H16BrF2NS and a molecular weight of 360.27 g/mol. Its IUPAC name is 1-(2-bromo-3,4-difluorophenyl)-2-(5-ethylthiophen-2-yl)-N-methylethanamine.
| Compound Name | 1-(2-bromo-3,4-difluorophenyl)-2-(5-ethylthiophen-2-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 107539084 |
| Molecular Formula | C15H16BrF2NS |
| Molecular Weight | 360.27 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | 1-(2-bromo-3,4-difluorophenyl)-2-(5-ethylthiophen-2-yl)-N-methylethanamine |
| SMILES | CCc1ccc(CC(NC)c2ccc(F)c(F)c2Br)s1 |
| InChI | InChI=1S/C15H16BrF2NS/c1-3-9-4-5-10(20-9)8-13(19-2)11-6-7-12(17)15(18)14(11)16/h4-7,13,19H,3,8H2,1-2H3 |
| InChIKey | RFWCCFXTKFOONS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.27 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|