C14H12Br2F2N2 — CID 107539014
1-(2-bromo-3,4-difluorophenyl)-2-(5-bromo-2-pyridinyl)-N-methylethanamine (PubChem CID 107539014) has the molecular formula C14H12Br2F2N2 and a molecular weight of 406.07 g/mol. Its IUPAC name is 1-(2-bromo-3,4-difluorophenyl)-2-(5-bromo-2-pyridinyl)-N-methylethanamine.
| Compound Name | 1-(2-bromo-3,4-difluorophenyl)-2-(5-bromo-2-pyridinyl)-N-methylethanamine |
|---|---|
| PubChem CID | 107539014 |
| Molecular Formula | C14H12Br2F2N2 |
| Molecular Weight | 406.07 g/mol |
| Exact Mass | 403.93 |
| IUPAC Name | 1-(2-bromo-3,4-difluorophenyl)-2-(5-bromo-2-pyridinyl)-N-methylethanamine |
| SMILES | CNC(Cc1ccc(Br)cn1)c1ccc(F)c(F)c1Br |
| InChI | InChI=1S/C14H12Br2F2N2/c1-19-12(6-9-3-2-8(15)7-20-9)10-4-5-11(17)14(18)13(10)16/h2-5,7,12,19H,6H2,1H3 |
| InChIKey | BOBSMFIDBYDMGQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.07 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|