C30H36NO3P — CID 67778550
3-[[4-[4-(3,4-dimethylphenyl)-3-(3-methylphenyl)but-1-ynyl]-3-methylphenyl]methylamino]propylphosphonic acid (PubChem CID 67778550) has the molecular formula C30H36NO3P and a molecular weight of 489.60 g/mol. Its IUPAC name is 3-[[4-[4-(3,4-dimethylphenyl)-3-(3-methylphenyl)but-1-ynyl]-3-methylphenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[4-[4-(3,4-dimethylphenyl)-3-(3-methylphenyl)but-1-ynyl]-3-methylphenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 67778550 |
| Molecular Formula | C30H36NO3P |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | 3-[[4-[4-(3,4-dimethylphenyl)-3-(3-methylphenyl)but-1-ynyl]-3-methylphenyl]methylamino]propylphosphonic acid |
| SMILES | Cc1cccc(C(C#Cc2ccc(CNCCCP(=O)(O)O)cc2C)Cc2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C30H36NO3P/c1-22-7-5-8-29(17-22)30(20-26-10-9-23(2)24(3)18-26)14-13-28-12-11-27(19-25(28)4)21-31-15-6-16-35(32,33)34/h5,7-12,17-19,30-31H,6,15-16,20-21H2,1-4H3,(H2,32,33,34) |
| InChIKey | LMNHEGNJXRYJQG-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|