C28H34F2NO4P — CID 118077919
3-[[4-[4-(3,5-difluorophenyl)-4-(3,4-dimethylphenyl)butoxy]phenyl]methylamino]propylphosphonic acid (PubChem CID 118077919) has the molecular formula C28H34F2NO4P and a molecular weight of 517.55 g/mol. Its IUPAC name is 3-[[4-[4-(3,5-difluorophenyl)-4-(3,4-dimethylphenyl)butoxy]phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[4-[4-(3,5-difluorophenyl)-4-(3,4-dimethylphenyl)butoxy]phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 118077919 |
| Molecular Formula | C28H34F2NO4P |
| Molecular Weight | 517.55 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | 3-[[4-[4-(3,5-difluorophenyl)-4-(3,4-dimethylphenyl)butoxy]phenyl]methylamino]propylphosphonic acid |
| SMILES | Cc1ccc(C(CCCOc2ccc(CNCCCP(=O)(O)O)cc2)c2cc(F)cc(F)c2)cc1C |
| InChI | InChI=1S/C28H34F2NO4P/c1-20-6-9-23(15-21(20)2)28(24-16-25(29)18-26(30)17-24)5-3-13-35-27-10-7-22(8-11-27)19-31-12-4-14-36(32,33)34/h6-11,15-18,28,31H,3-5,12-14,19H2,1-2H3,(H2,32,33,34) |
| InChIKey | WLYRMXBQJMQYDQ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.55 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|