C31H40F2NOP — CID 144844810
N-[[4-[5-(2,4-difluorophenyl)-5-(3,4-dimethylphenyl)pentoxy]-3-methylphenyl]methyl]-3-methylphosphanylpropan-1-amine (PubChem CID 144844810) has the molecular formula C31H40F2NOP and a molecular weight of 511.64 g/mol. Its IUPAC name is N-[[4-[5-(2,4-difluorophenyl)-5-(3,4-dimethylphenyl)pentoxy]-3-methylphenyl]methyl]-3-methylphosphanylpropan-1-amine.
| Compound Name | N-[[4-[5-(2,4-difluorophenyl)-5-(3,4-dimethylphenyl)pentoxy]-3-methylphenyl]methyl]-3-methylphosphanylpropan-1-amine |
|---|---|
| PubChem CID | 144844810 |
| Molecular Formula | C31H40F2NOP |
| Molecular Weight | 511.64 g/mol |
| Exact Mass | 511.28 |
| IUPAC Name | N-[[4-[5-(2,4-difluorophenyl)-5-(3,4-dimethylphenyl)pentoxy]-3-methylphenyl]methyl]-3-methylphosphanylpropan-1-amine |
| SMILES | CPCCCNCc1ccc(OCCCCC(c2ccc(C)c(C)c2)c2ccc(F)cc2F)c(C)c1 |
| InChI | InChI=1S/C31H40F2NOP/c1-22-9-11-26(19-23(22)2)28(29-13-12-27(32)20-30(29)33)8-5-6-16-35-31-14-10-25(18-24(31)3)21-34-15-7-17-36-4/h9-14,18-20,28,34,36H,5-8,15-17,21H2,1-4H3 |
| InChIKey | AVPPBOOWCACFAJ-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.64 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|