C14H22FNO — CID 113340247
5-[(4-fluoro-3-methylphenyl)methylamino]-2-methylpentan-1-ol (PubChem CID 113340247) has the molecular formula C14H22FNO and a molecular weight of 239.33 g/mol. Its IUPAC name is 5-[(4-fluoro-3-methylphenyl)methylamino]-2-methylpentan-1-ol.
| Compound Name | 5-[(4-fluoro-3-methylphenyl)methylamino]-2-methylpentan-1-ol |
|---|---|
| PubChem CID | 113340247 |
| Molecular Formula | C14H22FNO |
| Molecular Weight | 239.33 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 5-[(4-fluoro-3-methylphenyl)methylamino]-2-methylpentan-1-ol |
| SMILES | Cc1cc(CNCCCC(C)CO)ccc1F |
| InChI | InChI=1S/C14H22FNO/c1-11(10-17)4-3-7-16-9-13-5-6-14(15)12(2)8-13/h5-6,8,11,16-17H,3-4,7,9-10H2,1-2H3 |
| InChIKey | BILNDCGMABQTNM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|