C13H20FN — CID 62692850
N-[(4-fluoro-3-methylphenyl)methyl]-2-methylbutan-1-amine (PubChem CID 62692850) has the molecular formula C13H20FN and a molecular weight of 209.31 g/mol. Its IUPAC name is N-[(4-fluoro-3-methylphenyl)methyl]-2-methylbutan-1-amine.
| Compound Name | N-[(4-fluoro-3-methylphenyl)methyl]-2-methylbutan-1-amine |
|---|---|
| PubChem CID | 62692850 |
| Molecular Formula | C13H20FN |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | N-[(4-fluoro-3-methylphenyl)methyl]-2-methylbutan-1-amine |
| SMILES | CCC(C)CNCc1ccc(F)c(C)c1 |
| InChI | InChI=1S/C13H20FN/c1-4-10(2)8-15-9-12-5-6-13(14)11(3)7-12/h5-7,10,15H,4,8-9H2,1-3H3 |
| InChIKey | IDGVUUJTOXEBIQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |