C14H20FNO2 — CID 115253118
methyl 2-[[(4-fluoro-3-methylphenyl)methylamino]methyl]butanoate (PubChem CID 115253118) has the molecular formula C14H20FNO2 and a molecular weight of 253.32 g/mol. Its IUPAC name is methyl 2-[[(4-fluoro-3-methylphenyl)methylamino]methyl]butanoate.
| Compound Name | methyl 2-[[(4-fluoro-3-methylphenyl)methylamino]methyl]butanoate |
|---|---|
| PubChem CID | 115253118 |
| Molecular Formula | C14H20FNO2 |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | methyl 2-[[(4-fluoro-3-methylphenyl)methylamino]methyl]butanoate |
| SMILES | CCC(CNCc1ccc(F)c(C)c1)C(=O)OC |
| InChI | InChI=1S/C14H20FNO2/c1-4-12(14(17)18-3)9-16-8-11-5-6-13(15)10(2)7-11/h5-7,12,16H,4,8-9H2,1-3H3 |
| InChIKey | IEPZXWUQNJUASI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |