C13H18FNO — CID 115236437
5-[(4-fluoro-3-methylphenyl)methylamino]pentan-2-one (PubChem CID 115236437) has the molecular formula C13H18FNO and a molecular weight of 223.29 g/mol. Its IUPAC name is 5-[(4-fluoro-3-methylphenyl)methylamino]pentan-2-one.
| Compound Name | 5-[(4-fluoro-3-methylphenyl)methylamino]pentan-2-one |
|---|---|
| PubChem CID | 115236437 |
| Molecular Formula | C13H18FNO |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 5-[(4-fluoro-3-methylphenyl)methylamino]pentan-2-one |
| SMILES | CC(=O)CCCNCc1ccc(F)c(C)c1 |
| InChI | InChI=1S/C13H18FNO/c1-10-8-12(5-6-13(10)14)9-15-7-3-4-11(2)16/h5-6,8,15H,3-4,7,9H2,1-2H3 |
| InChIKey | FZLMCUBWXFVJLM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|