C25H24ClFO2 — CID 118085307
4-[4-(3-chlorophenyl)-4-(3,4-dimethylphenyl)butoxy]-3-fluorobenzaldehyde (PubChem CID 118085307) has the molecular formula C25H24ClFO2 and a molecular weight of 410.92 g/mol. Its IUPAC name is 4-[4-(3-chlorophenyl)-4-(3,4-dimethylphenyl)butoxy]-3-fluorobenzaldehyde.
| Compound Name | 4-[4-(3-chlorophenyl)-4-(3,4-dimethylphenyl)butoxy]-3-fluorobenzaldehyde |
|---|---|
| PubChem CID | 118085307 |
| Molecular Formula | C25H24ClFO2 |
| Molecular Weight | 410.92 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 4-[4-(3-chlorophenyl)-4-(3,4-dimethylphenyl)butoxy]-3-fluorobenzaldehyde |
| SMILES | Cc1ccc(C(CCCOc2ccc(C=O)cc2F)c2cccc(Cl)c2)cc1C |
| InChI | InChI=1S/C25H24ClFO2/c1-17-8-10-21(13-18(17)2)23(20-5-3-6-22(26)15-20)7-4-12-29-25-11-9-19(16-28)14-24(25)27/h3,5-6,8-11,13-16,23H,4,7,12H2,1-2H3 |
| InChIKey | NFUQFWYBDVFGMD-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.92 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|