C18H20BrF — CID 125465630
4-[(1S)-4-bromo-1-(3-fluorophenyl)butyl]-1,2-dimethylbenzene (PubChem CID 125465630) has the molecular formula C18H20BrF and a molecular weight of 335.26 g/mol. Its IUPAC name is 4-[(1S)-4-bromo-1-(3-fluorophenyl)butyl]-1,2-dimethylbenzene.
| Compound Name | 4-[(1S)-4-bromo-1-(3-fluorophenyl)butyl]-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 125465630 |
| Molecular Formula | C18H20BrF |
| Molecular Weight | 335.26 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 4-[(1S)-4-bromo-1-(3-fluorophenyl)butyl]-1,2-dimethylbenzene |
| SMILES | Cc1ccc([C@H](CCCBr)c2cccc(F)c2)cc1C |
| InChI | InChI=1S/C18H20BrF/c1-13-8-9-16(11-14(13)2)18(7-4-10-19)15-5-3-6-17(20)12-15/h3,5-6,8-9,11-12,18H,4,7,10H2,1-2H3/t18-/m1/s1 |
| InChIKey | PFUZVJMEDPARPX-GOSISDBHSA-N |
| XLogP | 5.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.26 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|