C18H19BrF2 — CID 125465627
4-[(1R)-4-bromo-1-(3,4-difluorophenyl)butyl]-1,2-dimethylbenzene (PubChem CID 125465627) has the molecular formula C18H19BrF2 and a molecular weight of 353.25 g/mol. Its IUPAC name is 4-[(1R)-4-bromo-1-(3,4-difluorophenyl)butyl]-1,2-dimethylbenzene.
| Compound Name | 4-[(1R)-4-bromo-1-(3,4-difluorophenyl)butyl]-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 125465627 |
| Molecular Formula | C18H19BrF2 |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 4-[(1R)-4-bromo-1-(3,4-difluorophenyl)butyl]-1,2-dimethylbenzene |
| SMILES | Cc1ccc([C@@H](CCCBr)c2ccc(F)c(F)c2)cc1C |
| InChI | InChI=1S/C18H19BrF2/c1-12-5-6-14(10-13(12)2)16(4-3-9-19)15-7-8-17(20)18(21)11-15/h5-8,10-11,16H,3-4,9H2,1-2H3/t16-/m1/s1 |
| InChIKey | OWVRNUUDPNFABL-MRXNPFEDSA-N |
| XLogP | 5.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|